C19H17BrN6O3 — CID 72546030
2-amino-N-[(E)-[1-(4-bromophenyl)-2-(2-methyl-5-nitroimidazol-1-yl)ethylidene]amino]benzamide (PubChem CID 72546030) has the molecular formula C19H17BrN6O3 and a molecular weight of 457.29 g/mol. Its IUPAC name is 2-amino-N-[(E)-[1-(4-bromophenyl)-2-(2-methyl-5-nitroimidazol-1-yl)ethylidene]amino]benzamide.
| Compound Name | 2-amino-N-[(E)-[1-(4-bromophenyl)-2-(2-methyl-5-nitroimidazol-1-yl)ethylidene]amino]benzamide |
|---|---|
| PubChem CID | 72546030 |
| Molecular Formula | C19H17BrN6O3 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 2-amino-N-[(E)-[1-(4-bromophenyl)-2-(2-methyl-5-nitroimidazol-1-yl)ethylidene]amino]benzamide |
| SMILES | Cc1ncc([N+](=O)[O-])n1C/C(=N/NC(=O)c1ccccc1N)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrN6O3/c1-12-22-10-18(26(28)29)25(12)11-17(13-6-8-14(20)9-7-13)23-24-19(27)15-4-2-3-5-16(15)21/h2-10H,11,21H2,1H3,(H,24,27)/b23-17- |
| InChIKey | YIKPLJBZSZRMQO-QJOMJCCJSA-N |
| XLogP | 3.28 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|