C46H38 — CID 72556056
9-(2,3-dihydronaphthalen-1-yl)-10-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2-naphthalen-2-yl-4a,9a-dihydroanthracene (PubChem CID 72556056) has the molecular formula C46H38 and a molecular weight of 590.81 g/mol. Its IUPAC name is 9-(2,3-dihydronaphthalen-1-yl)-10-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2-naphthalen-2-yl-4a,9a-dihydroanthracene.
| Compound Name | 9-(2,3-dihydronaphthalen-1-yl)-10-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2-naphthalen-2-yl-4a,9a-dihydroanthracene |
|---|---|
| PubChem CID | 72556056 |
| Molecular Formula | C46H38 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 9-(2,3-dihydronaphthalen-1-yl)-10-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2-naphthalen-2-yl-4a,9a-dihydroanthracene |
| SMILES | C=CC=CC(=C)C(=C)C=CC(=C)C1=c2ccccc2=C(C2=c3ccccc3=CCC2)C2C=C(c3ccc4ccccc4c3)C=CC12 |
| InChI | InChI=1S/C46H38/c1-5-6-14-31(2)32(3)23-24-33(4)45-41-20-11-12-21-42(41)46(40-22-13-18-35-16-9-10-19-39(35)40)44-30-38(27-28-43(44)45)37-26-25-34-15-7-8-17-36(34)29-37/h5-12,14-21,23-30,43-44H,1-4,13,22H2 |
| InChIKey | SQNMFFIYRAYRHW-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|