C31H37N2O3S+ — CID 72610057
2-[5-[1-(4-hydroperoxybutyl)-6-methylquinolin-1-ium-4-yl]-3-methylpenta-2,4-dienylidene]-4-methoxy-3-propyl-1,3-benzothiazole (PubChem CID 72610057) has the molecular formula C31H37N2O3S+ and a molecular weight of 517.72 g/mol. Its IUPAC name is 2-[5-[1-(4-hydroperoxybutyl)-6-methylquinolin-1-ium-4-yl]-3-methylpenta-2,4-dienylidene]-4-methoxy-3-propyl-1,3-benzothiazole.
| Compound Name | 2-[5-[1-(4-hydroperoxybutyl)-6-methylquinolin-1-ium-4-yl]-3-methylpenta-2,4-dienylidene]-4-methoxy-3-propyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 72610057 |
| Molecular Formula | C31H37N2O3S+ |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-[5-[1-(4-hydroperoxybutyl)-6-methylquinolin-1-ium-4-yl]-3-methylpenta-2,4-dienylidene]-4-methoxy-3-propyl-1,3-benzothiazole |
| SMILES | CCCN1C(=CC=C(C)C=Cc2cc[n+](CCCCOO)c3ccc(C)cc23)Sc2cccc(OC)c21 |
| InChI | InChI=1S/C31H36N2O3S/c1-5-18-33-30(37-29-10-8-9-28(35-4)31(29)33)16-13-23(2)11-14-25-17-20-32(19-6-7-21-36-34)27-15-12-24(3)22-26(25)27/h8-17,20,22H,5-7,18-19,21H2,1-4H3/p+1 |
| InChIKey | ZGZCJWRQUMKHFI-UHFFFAOYSA-O |
| XLogP | 7.54 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|