C23H19BrClN3O4 — CID 72634826
8-bromo-4-(2-chlorophenyl)-N-(2-hydroxycyclopentyl)-6-methyl-1,3-dioxopyrrolo[3,4-e]indole-7-carboxamide (PubChem CID 72634826) has the molecular formula C23H19BrClN3O4 and a molecular weight of 516.78 g/mol. Its IUPAC name is 8-bromo-4-(2-chlorophenyl)-N-(2-hydroxycyclopentyl)-6-methyl-1,3-dioxopyrrolo[3,4-e]indole-7-carboxamide.
| Compound Name | 8-bromo-4-(2-chlorophenyl)-N-(2-hydroxycyclopentyl)-6-methyl-1,3-dioxopyrrolo[3,4-e]indole-7-carboxamide |
|---|---|
| PubChem CID | 72634826 |
| Molecular Formula | C23H19BrClN3O4 |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | 8-bromo-4-(2-chlorophenyl)-N-(2-hydroxycyclopentyl)-6-methyl-1,3-dioxopyrrolo[3,4-e]indole-7-carboxamide |
| SMILES | Cn1c(C(=O)NC2CCCC2O)c(Br)c2c3c(c(-c4ccccc4Cl)cc21)C(=O)NC3=O |
| InChI | InChI=1S/C23H19BrClN3O4/c1-28-14-9-11(10-5-2-3-6-12(10)25)16-18(22(31)27-21(16)30)17(14)19(24)20(28)23(32)26-13-7-4-8-15(13)29/h2-3,5-6,9,13,15,29H,4,7-8H2,1H3,(H,26,32)(H,27,30,31) |
| InChIKey | VKFJJIRTVZDGJI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|