C13H23FN5O7P3 — CID 72638430
[5-(3-carbamimidoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-[fluoro(phosphanyl)phosphanyl]but-2-enyl methyl phosphate (PubChem CID 72638430) has the molecular formula C13H23FN5O7P3 and a molecular weight of 473.28 g/mol. Its IUPAC name is [5-(3-carbamimidoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-[fluoro(phosphanyl)phosphanyl]but-2-enyl methyl phosphate.
| Compound Name | [5-(3-carbamimidoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-[fluoro(phosphanyl)phosphanyl]but-2-enyl methyl phosphate |
|---|---|
| PubChem CID | 72638430 |
| Molecular Formula | C13H23FN5O7P3 |
| Molecular Weight | 473.28 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [5-(3-carbamimidoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-[fluoro(phosphanyl)phosphanyl]but-2-enyl methyl phosphate |
| SMILES | [H]/N=C(\N)c1ncn(C2OC(COP(=O)(OC)OCC=C(C)P(F)P)C(O)C2O)n1 |
| InChI | InChI=1S/C13H23FN5O7P3/c1-7(28(14)27)3-4-24-29(22,23-2)25-5-8-9(20)10(21)13(26-8)19-6-17-12(18-19)11(15)16/h3,6,8-10,13,20-21H,4-5,27H2,1-2H3,(H3,15,16) |
| InChIKey | LTBOIIZQWYPMHT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 175.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|