C31H31F3N4O9 — CID 72654184
4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 72654184) has the molecular formula C31H31F3N4O9 and a molecular weight of 660.60 g/mol. Its IUPAC name is 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 72654184 |
| Molecular Formula | C31H31F3N4O9 |
| Molecular Weight | 660.60 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc3c(c2O)C(O)=C2C(=O)C4(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C4C(O)C2C3C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H31F3N4O9/c1-10-5-7-14(13(9-10)31(32,33)34)36-29(46)37-15-8-6-12-11(2)16-18(23(40)17(12)22(15)39)26(43)30(47)20(24(16)41)21(38(3)4)25(42)19(27(30)44)28(35)45/h5-9,11,16,20-21,24,39-41,44,47H,1-4H3,(H2,35,45)(H2,36,37,46) |
| InChIKey | BBRKUSVLOZSZSX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 222.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|