C14H12Cl2N2O — CID 72689361
N-[cyano-(2,3-dichlorophenyl)methyl]hexa-2,4-dienamide (PubChem CID 72689361) has the molecular formula C14H12Cl2N2O and a molecular weight of 295.17 g/mol. Its IUPAC name is N-[cyano-(2,3-dichlorophenyl)methyl]hexa-2,4-dienamide.
| Compound Name | N-[cyano-(2,3-dichlorophenyl)methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 72689361 |
| Molecular Formula | C14H12Cl2N2O |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | N-[cyano-(2,3-dichlorophenyl)methyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NC(C#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H12Cl2N2O/c1-2-3-4-8-13(19)18-12(9-17)10-6-5-7-11(15)14(10)16/h2-8,12H,1H3,(H,18,19) |
| InChIKey | YGEIZVZYAHVASH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|