C18H23IO5 — CID 72697968
(3aR,4R,5S,7aR)-6-iodo-4-[(4-methoxyphenyl)methoxy]-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxol-5-ol (PubChem CID 72697968) has the molecular formula C18H23IO5 and a molecular weight of 446.28 g/mol. Its IUPAC name is (3aR,4R,5S,7aR)-6-iodo-4-[(4-methoxyphenyl)methoxy]-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxol-5-ol.
| Compound Name | (3aR,4R,5S,7aR)-6-iodo-4-[(4-methoxyphenyl)methoxy]-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 72697968 |
| Molecular Formula | C18H23IO5 |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (3aR,4R,5S,7aR)-6-iodo-4-[(4-methoxyphenyl)methoxy]-2,2,3a-trimethyl-5,7a-dihydro-4H-1,3-benzodioxol-5-ol |
| SMILES | COc1ccc(CO[C@@H]2[C@H](O)C(I)=C[C@H]3OC(C)(C)O[C@@]23C)cc1 |
| InChI | InChI=1S/C18H23IO5/c1-17(2)23-14-9-13(19)15(20)16(18(14,3)24-17)22-10-11-5-7-12(21-4)8-6-11/h5-9,14-16,20H,10H2,1-4H3/t14-,15-,16-,18-/m1/s1 |
| InChIKey | JKGMTLVVEMLVQB-YFHUEUNASA-N |
| XLogP | 3.18 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|