C17H11BrCl2N2O3 — CID 72714820
5-bromo-1-(4-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 72714820) has the molecular formula C17H11BrCl2N2O3 and a molecular weight of 442.10 g/mol. Its IUPAC name is 5-bromo-1-(4-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-bromo-1-(4-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 72714820 |
| Molecular Formula | C17H11BrCl2N2O3 |
| Molecular Weight | 442.10 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | 5-bromo-1-(4-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(Br)(Cc2ccc(Cl)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11BrCl2N2O3/c18-17(9-10-1-3-11(19)4-2-10)14(23)21-16(25)22(15(17)24)13-7-5-12(20)6-8-13/h1-8H,9H2,(H,21,23,25) |
| InChIKey | RDQJXYNLOVHANC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.10 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|