C26H29N6S+ — CID 72721943
2-[3-[[1-phenyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]pyridin-1-ium-2-yl]amino]propyl]guanidine (PubChem CID 72721943) has the molecular formula C26H29N6S+ and a molecular weight of 457.63 g/mol. Its IUPAC name is 2-[3-[[1-phenyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]pyridin-1-ium-2-yl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[1-phenyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]pyridin-1-ium-2-yl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 72721943 |
| Molecular Formula | C26H29N6S+ |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[3-[[1-phenyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]pyridin-1-ium-2-yl]amino]propyl]guanidine |
| SMILES | NC(N)=NCCCNc1cc(/C=C2\Sc3cccc4c3N2CCC4)cc[n+]1-c1ccccc1 |
| InChI | InChI=1S/C26H28N6S/c27-26(28)30-14-6-13-29-23-17-19(12-16-31(23)21-9-2-1-3-10-21)18-24-32-15-5-8-20-7-4-11-22(33-24)25(20)32/h1-4,7,9-12,16-18H,5-6,8,13-15H2,(H4,27,28,30)/p+1/b24-18- |
| InChIKey | JORSMSGYOKRDQL-MOHJPFBDSA-O |
| XLogP | 3.90 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|