C17H17F3N4S2 — CID 72723487
[4-(trifluoromethyl)phenyl]methyl 4-pyrimidin-2-ylpiperazine-1-carbodithioate (PubChem CID 72723487) has the molecular formula C17H17F3N4S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 4-pyrimidin-2-ylpiperazine-1-carbodithioate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 4-pyrimidin-2-ylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 72723487 |
| Molecular Formula | C17H17F3N4S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 4-pyrimidin-2-ylpiperazine-1-carbodithioate |
| SMILES | FC(F)(F)c1ccc(CSC(=S)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C17H17F3N4S2/c18-17(19,20)14-4-2-13(3-5-14)12-26-16(25)24-10-8-23(9-11-24)15-21-6-1-7-22-15/h1-7H,8-12H2 |
| InChIKey | XBXHIZCZKOHHLB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|