C17H15ClN2O6S — CID 72739414
5-[C-[[(4-chlorophenyl)sulfonylamino]methyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1-benzofuran-2-carboxylic acid (PubChem CID 72739414) has the molecular formula C17H15ClN2O6S and a molecular weight of 410.84 g/mol. Its IUPAC name is 5-[C-[[(4-chlorophenyl)sulfonylamino]methyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[C-[[(4-chlorophenyl)sulfonylamino]methyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 72739414 |
| Molecular Formula | C17H15ClN2O6S |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 5-[C-[[(4-chlorophenyl)sulfonylamino]methyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(C(CNS(=O)(=O)c3ccc(Cl)cc3)=NO)ccc2O1 |
| InChI | InChI=1S/C17H15ClN2O6S/c18-12-2-4-13(5-3-12)27(24,25)19-9-14(20-23)10-1-6-15-11(7-10)8-16(26-15)17(21)22/h1-7,16,19,23H,8-9H2,(H,21,22) |
| InChIKey | UDHUTIIFZYFYBO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|