C10H20N3S+ — CID 7275534
5-tert-butyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione (PubChem CID 7275534) has the molecular formula C10H20N3S+ and a molecular weight of 214.36 g/mol. Its IUPAC name is 5-tert-butyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 5-tert-butyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 7275534 |
| Molecular Formula | C10H20N3S+ |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 5-tert-butyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione |
| SMILES | C=CCN1C[NH+](C(C)(C)C)CNC1=S |
| InChI | InChI=1S/C10H19N3S/c1-5-6-12-8-13(10(2,3)4)7-11-9(12)14/h5H,1,6-8H2,2-4H3,(H,11,14)/p+1 |
| InChIKey | SGPQDZXHPQSWLS-UHFFFAOYSA-O |
| XLogP | -0.04 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|