C19H19N3O2 — CID 7282705
(2R)-2-(2-hydroxy-3-methoxyphenyl)-2-[(3S)-5-methyl-3-phenyl-3,4-dihydropyrazol-2-yl]acetonitrile (PubChem CID 7282705) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2R)-2-(2-hydroxy-3-methoxyphenyl)-2-[(3S)-5-methyl-3-phenyl-3,4-dihydropyrazol-2-yl]acetonitrile.
| Compound Name | (2R)-2-(2-hydroxy-3-methoxyphenyl)-2-[(3S)-5-methyl-3-phenyl-3,4-dihydropyrazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 7282705 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (2R)-2-(2-hydroxy-3-methoxyphenyl)-2-[(3S)-5-methyl-3-phenyl-3,4-dihydropyrazol-2-yl]acetonitrile |
| SMILES | COc1cccc([C@H](C#N)N2N=C(C)C[C@H]2c2ccccc2)c1O |
| InChI | InChI=1S/C19H19N3O2/c1-13-11-16(14-7-4-3-5-8-14)22(21-13)17(12-20)15-9-6-10-18(24-2)19(15)23/h3-10,16-17,23H,11H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | BCVANOKFMWNSTE-IRXDYDNUSA-N |
| XLogP | 3.79 |
| TPSA | 68.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|