C16H21N7O — CID 72920930
1-[3-(benzotriazol-1-yl)propyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea (PubChem CID 72920930) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[3-(benzotriazol-1-yl)propyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea.
| Compound Name | 1-[3-(benzotriazol-1-yl)propyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 72920930 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[3-(benzotriazol-1-yl)propyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea |
| SMILES | Cc1nn(C)c(C)c1NC(=O)NCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C16H21N7O/c1-11-15(12(2)22(3)20-11)18-16(24)17-9-6-10-23-14-8-5-4-7-13(14)19-21-23/h4-5,7-8H,6,9-10H2,1-3H3,(H2,17,18,24) |
| InChIKey | DBDLUXDXYGHOCZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|