C12H17N5OS2 — CID 72934920
6-(methoxymethyl)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidin-4-amine (PubChem CID 72934920) has the molecular formula C12H17N5OS2 and a molecular weight of 311.44 g/mol. Its IUPAC name is 6-(methoxymethyl)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidin-4-amine.
| Compound Name | 6-(methoxymethyl)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72934920 |
| Molecular Formula | C12H17N5OS2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 6-(methoxymethyl)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidin-4-amine |
| SMILES | COCc1cc(NCCCSc2nnc(C)s2)ncn1 |
| InChI | InChI=1S/C12H17N5OS2/c1-9-16-17-12(20-9)19-5-3-4-13-11-6-10(7-18-2)14-8-15-11/h6,8H,3-5,7H2,1-2H3,(H,13,14,15) |
| InChIKey | KUJASNJUHLBUNK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|