C13H17N7S2 — CID 176500086
6,7-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-amine (PubChem CID 176500086) has the molecular formula C13H17N7S2 and a molecular weight of 335.46 g/mol. Its IUPAC name is 6,7-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-amine.
| Compound Name | 6,7-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-amine |
|---|---|
| PubChem CID | 176500086 |
| Molecular Formula | C13H17N7S2 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 6,7-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-amine |
| SMILES | Cc1nnc(SCCCNc2c(C)c(C)nn3cnnc23)s1 |
| InChI | InChI=1S/C13H17N7S2/c1-8-9(2)19-20-7-15-17-12(20)11(8)14-5-4-6-21-13-18-16-10(3)22-13/h7,14H,4-6H2,1-3H3 |
| InChIKey | HTNPCJGHXQRPTG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|