C21H20F2N4O4 — CID 72946765
13-(cyclopropylmethyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione (PubChem CID 72946765) has the molecular formula C21H20F2N4O4 and a molecular weight of 430.41 g/mol. Its IUPAC name is 13-(cyclopropylmethyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione.
| Compound Name | 13-(cyclopropylmethyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
|---|---|
| PubChem CID | 72946765 |
| Molecular Formula | C21H20F2N4O4 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 13-(cyclopropylmethyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c3N(CC3CC3)C2=O)CC(=O)N4)c1F |
| InChI | InChI=1S/C21H20F2N4O4/c1-30-13-6-14(31-2)17(23)19(16(13)22)27-9-11-7-24-20-12(5-15(28)25-20)18(11)26(21(27)29)8-10-3-4-10/h6-7,10H,3-5,8-9H2,1-2H3,(H,24,25,28) |
| InChIKey | YKVCPGLYXSLOHD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |