C23H23ClN4O3 — CID 72962930
N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 72962930) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 72962930 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(NC(=O)C=Cc3ccccc3Cl)cc2)no1 |
| InChI | InChI=1S/C23H23ClN4O3/c1-23(2,3)19-14-20(28-31-19)27-22(30)26-17-11-9-16(10-12-17)25-21(29)13-8-15-6-4-5-7-18(15)24/h4-14H,1-3H3,(H,25,29)(H2,26,27,28,30) |
| InChIKey | YTFFFEKNCCKOCX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|