C29H46O8 — CID 72963620
[6,10-dihydroxy-2-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-12-oxo-1-oxacyclododec-4-en-7-yl] acetate (PubChem CID 72963620) has the molecular formula C29H46O8 and a molecular weight of 522.68 g/mol. Its IUPAC name is [6,10-dihydroxy-2-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-12-oxo-1-oxacyclododec-4-en-7-yl] acetate.
| Compound Name | [6,10-dihydroxy-2-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-12-oxo-1-oxacyclododec-4-en-7-yl] acetate |
|---|---|
| PubChem CID | 72963620 |
| Molecular Formula | C29H46O8 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | [6,10-dihydroxy-2-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-12-oxo-1-oxacyclododec-4-en-7-yl] acetate |
| SMILES | CCC(O)C(C)C1OC1CC(C)C=CC=C(C)C1OC(=O)CC(O)CCC(OC(C)=O)C(O)C=CC1C |
| InChI | InChI=1S/C29H46O8/c1-7-23(32)20(5)29-26(36-29)15-17(2)9-8-10-18(3)28-19(4)11-13-24(33)25(35-21(6)30)14-12-22(31)16-27(34)37-28/h8-11,13,17,19-20,22-26,28-29,31-33H,7,12,14-16H2,1-6H3 |
| InChIKey | AZZZCQLPUAARQE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|