C22H29N3O — CID 73011049
1-[3-(benzotriazol-2-yl)-5-pentylphenyl]pentan-2-ol (PubChem CID 73011049) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-[3-(benzotriazol-2-yl)-5-pentylphenyl]pentan-2-ol.
| Compound Name | 1-[3-(benzotriazol-2-yl)-5-pentylphenyl]pentan-2-ol |
|---|---|
| PubChem CID | 73011049 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 1-[3-(benzotriazol-2-yl)-5-pentylphenyl]pentan-2-ol |
| SMILES | CCCCCc1cc(CC(O)CCC)cc(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C22H29N3O/c1-3-5-6-10-17-13-18(16-20(26)9-4-2)15-19(14-17)25-23-21-11-7-8-12-22(21)24-25/h7-8,11-15,20,26H,3-6,9-10,16H2,1-2H3 |
| InChIKey | KNQFGKYCUMPAHP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|