C17H18BrN3O3 — CID 7303047
3-[(4Z)-4-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]propanenitrile (PubChem CID 7303047) has the molecular formula C17H18BrN3O3 and a molecular weight of 392.25 g/mol. Its IUPAC name is 3-[(4Z)-4-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]propanenitrile.
| Compound Name | 3-[(4Z)-4-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 7303047 |
| Molecular Formula | C17H18BrN3O3 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-[(4Z)-4-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]propanenitrile |
| SMILES | CCOc1cc(Br)c(/C=C2\C(=O)N(CCC#N)N=C2C)cc1OC |
| InChI | InChI=1S/C17H18BrN3O3/c1-4-24-16-10-14(18)12(9-15(16)23-3)8-13-11(2)20-21(17(13)22)7-5-6-19/h8-10H,4-5,7H2,1-3H3/b13-8- |
| InChIKey | HSBHRSSXXINLER-JYRVWZFOSA-N |
| XLogP | 3.37 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|