C17H12F2N2O3 — CID 73035779
3-[5-[3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 73035779) has the molecular formula C17H12F2N2O3 and a molecular weight of 330.29 g/mol. Its IUPAC name is 3-[5-[3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[5-[3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 73035779 |
| Molecular Formula | C17H12F2N2O3 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-[5-[3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(C=CC(=O)c2ccc(F)c(F)c2)cn1)NO |
| InChI | InChI=1S/C17H12F2N2O3/c18-14-6-3-12(9-15(14)19)16(22)7-2-11-1-4-13(20-10-11)5-8-17(23)21-24/h1-10,24H,(H,21,23) |
| InChIKey | CIRJSIKYRJLIET-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|