C19H24O7 — CID 73055414
(1S,2R,7S,9R,10E,14R,16R,18S)-2,4,10-trihydroxy-7,9,16-trimethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione (PubChem CID 73055414) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (1S,2R,7S,9R,10E,14R,16R,18S)-2,4,10-trihydroxy-7,9,16-trimethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione.
| Compound Name | (1S,2R,7S,9R,10E,14R,16R,18S)-2,4,10-trihydroxy-7,9,16-trimethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione |
|---|---|
| PubChem CID | 73055414 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1S,2R,7S,9R,10E,14R,16R,18S)-2,4,10-trihydroxy-7,9,16-trimethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione |
| SMILES | C[C@@H]1C[C@H](C)C(=O)C2C(O)C3[C@@H](O)[C@H]4O[C@]25/C(=C\1O)C(=O)O[C@]35C[C@H]4C |
| InChI | InChI=1S/C19H24O7/c1-6-4-7(2)13(21)11-17(24)26-18-5-8(3)16-15(23)9(18)14(22)10(12(6)20)19(11,18)25-16/h6-10,14-16,21-23H,4-5H2,1-3H3/b13-11+/t6-,7+,8+,9?,10?,14?,15+,16-,18+,19-/m0/s1 |
| InChIKey | VUYKDEHGBXWVQB-BWELLRFKSA-N |
| XLogP | 0.48 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |