C20H26O8 — CID 162852578
(1R,2S,3R,4S,5R,7S,9S,10Z,14R,16S,18R)-2,4,7,10-tetrahydroxy-1,7,9,16-tetramethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione (PubChem CID 162852578) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R,7S,9S,10Z,14R,16S,18R)-2,4,7,10-tetrahydroxy-1,7,9,16-tetramethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione.
| Compound Name | (1R,2S,3R,4S,5R,7S,9S,10Z,14R,16S,18R)-2,4,7,10-tetrahydroxy-1,7,9,16-tetramethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione |
|---|---|
| PubChem CID | 162852578 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (1R,2S,3R,4S,5R,7S,9S,10Z,14R,16S,18R)-2,4,7,10-tetrahydroxy-1,7,9,16-tetramethyl-13,17-dioxapentacyclo[9.5.2.03,14.05,18.014,18]octadec-10-ene-6,12-dione |
| SMILES | C[C@H]1C[C@](C)(O)C(=O)[C@@H]2[C@@H](O)[C@@H]3[C@H](O)[C@]4(C)O[C@@]25/C(=C\1O)C(=O)O[C@]35C[C@@H]4C |
| InChI | InChI=1S/C20H26O8/c1-7-5-17(3,26)14(23)10-13(22)9-15(24)18(4)8(2)6-19(9)20(10,28-18)11(12(7)21)16(25)27-19/h7-10,13,15,21-22,24,26H,5-6H2,1-4H3/b12-11+/t7-,8-,9+,10-,13-,15-,17-,18+,19+,20+/m0/s1 |
| InChIKey | MVFRGMBYWIQNOX-GPMGRXEVSA-N |
| XLogP | -0.01 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |