C21H32O6 — CID 163062639
17-ethyl-8,16-dihydroxy-4,6,10-trimethyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-1(16)-ene-11,15-dione (PubChem CID 163062639) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 17-ethyl-8,16-dihydroxy-4,6,10-trimethyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-1(16)-ene-11,15-dione.
| Compound Name | 17-ethyl-8,16-dihydroxy-4,6,10-trimethyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-1(16)-ene-11,15-dione |
|---|---|
| PubChem CID | 163062639 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 17-ethyl-8,16-dihydroxy-4,6,10-trimethyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-1(16)-ene-11,15-dione |
| SMILES | CCC1C(O)=C2CCC3(C)CC(C)C(O3)C(O)CC(C)C(=O)CC1OC2=O |
| InChI | InChI=1S/C21H32O6/c1-5-13-17-9-15(22)11(2)8-16(23)19-12(3)10-21(4,27-19)7-6-14(18(13)24)20(25)26-17/h11-13,16-17,19,23-24H,5-10H2,1-4H3 |
| InChIKey | WHJYUMSXIZMUHM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |