C23H34O5 — CID 163188990
(1R,4S,6S,7R,8R,13R,17R)-8-hydroxy-4,6,10-trimethyl-11-methylidene-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-9-ene-15,16-dione (PubChem CID 163188990) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (1R,4S,6S,7R,8R,13R,17R)-8-hydroxy-4,6,10-trimethyl-11-methylidene-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-9-ene-15,16-dione.
| Compound Name | (1R,4S,6S,7R,8R,13R,17R)-8-hydroxy-4,6,10-trimethyl-11-methylidene-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-9-ene-15,16-dione |
|---|---|
| PubChem CID | 163188990 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1R,4S,6S,7R,8R,13R,17R)-8-hydroxy-4,6,10-trimethyl-11-methylidene-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadec-9-ene-15,16-dione |
| SMILES | C=C1C[C@H]2OC(=O)[C@H](CC[C@@]3(C)C[C@H](C)[C@@H](O3)[C@H](O)C=C1C)C(=O)[C@@H]2CCC |
| InChI | InChI=1S/C23H34O5/c1-6-7-16-19-11-14(3)13(2)10-18(24)21-15(4)12-23(5,28-21)9-8-17(20(16)25)22(26)27-19/h10,15-19,21,24H,3,6-9,11-12H2,1-2,4-5H3/t15-,16+,17+,18+,19+,21+,23-/m0/s1 |
| InChIKey | HMKJOTJJBAJAAT-AOTVVXTOSA-N |
| XLogP | 3.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|