C22H32O6 — CID 78092420
8,16-dihydroxy-4,6,10-trimethyl-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadeca-1(16),9-diene-11,15-dione (PubChem CID 78092420) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 8,16-dihydroxy-4,6,10-trimethyl-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadeca-1(16),9-diene-11,15-dione.
| Compound Name | 8,16-dihydroxy-4,6,10-trimethyl-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadeca-1(16),9-diene-11,15-dione |
|---|---|
| PubChem CID | 78092420 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 8,16-dihydroxy-4,6,10-trimethyl-17-propyl-14,18-dioxatricyclo[11.2.2.14,7]octadeca-1(16),9-diene-11,15-dione |
| SMILES | CCCC1C(O)=C2CCC3(C)CC(C)C(O3)C(O)C=C(C)C(=O)CC1OC2=O |
| InChI | InChI=1S/C22H32O6/c1-5-6-14-18-10-16(23)12(2)9-17(24)20-13(3)11-22(4,28-20)8-7-15(19(14)25)21(26)27-18/h9,13-14,17-18,20,24-25H,5-8,10-11H2,1-4H3 |
| InChIKey | AFAXFXGTXQUJRU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |