C23H24O9 — CID 73105721
5,6,14-trihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-13-one (PubChem CID 73105721) has the molecular formula C23H24O9 and a molecular weight of 444.44 g/mol. Its IUPAC name is 5,6,14-trihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-13-one.
| Compound Name | 5,6,14-trihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-13-one |
|---|---|
| PubChem CID | 73105721 |
| Molecular Formula | C23H24O9 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 5,6,14-trihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-13-one |
| SMILES | COc1cc2c(cc1OC)C1(O)C(=O)c3ccc4c(c3OC1CO2)C(O)C(O)C(C)(C)O4 |
| InChI | InChI=1S/C23H24O9/c1-22(2)21(26)18(24)17-12(32-22)6-5-10-19(17)31-16-9-30-13-8-15(29-4)14(28-3)7-11(13)23(16,27)20(10)25/h5-8,16,18,21,24,26-27H,9H2,1-4H3 |
| InChIKey | XMGJLGOKKNELQY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |