About (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate
(3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate (PubChem CID 73116467) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate.
Analyze (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate?
The IUPAC name of (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate (CID 73116467) is (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate.
What is the SMILES notation for (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate?
The canonical SMILES for (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate is CC(=O)OCC1OC=CC(=O)C1O.
What is the InChIKey of (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate?
The InChIKey is VCBQIZCHUFWFQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c1-5(9)13-4-7-8(11)6(10)2-3-12-7/h2-3,7-8,11H,4H2,1H3.
What are the key properties of (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate?
(3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate has a molecular weight of 186.16 g/mol, XLogP of -0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-4-oxo-2,3-dihydropyran-2-yl)methyl acetate is sourced from PubChem (CID 73116467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).