C22H25N3O5S — CID 73147430
3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 73147430) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 73147430 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | COc1cc(OC)cc(N2C(=S)NC3C(O)C(O)CC(C(=O)Nc4ccccc4)C32)c1 |
| InChI | InChI=1S/C22H25N3O5S/c1-29-14-8-13(9-15(10-14)30-2)25-19-16(21(28)23-12-6-4-3-5-7-12)11-17(26)20(27)18(19)24-22(25)31/h3-10,16-20,26-27H,11H2,1-2H3,(H,23,28)(H,24,31) |
| InChIKey | ZAHTUEQSBKUSNX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|