C10H8Cl2Fe-2 — CID 73162912
cyclopenta-1,3-diene;1,5-dichlorocyclopenta-1,3-diene;iron (PubChem CID 73162912) has the molecular formula C10H8Cl2Fe-2 and a molecular weight of 254.93 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1,5-dichlorocyclopenta-1,3-diene;iron.
| Compound Name | cyclopenta-1,3-diene;1,5-dichlorocyclopenta-1,3-diene;iron |
|---|---|
| PubChem CID | 73162912 |
| Molecular Formula | C10H8Cl2Fe-2 |
| Molecular Weight | 254.93 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | cyclopenta-1,3-diene;1,5-dichlorocyclopenta-1,3-diene;iron |
| SMILES | Clc1ccc[c-]1Cl.[Fe].c1cc[cH-]c1 |
| InChI | InChI=1S/C5H3Cl2.C5H5.Fe/c6-4-2-1-3-5(4)7;1-2-4-5-3-1;/h1-3H;1-5H;/q2*-1; |
| InChIKey | KLINIRMHOFYZQL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|