C9H13NO — CID 73169110
[2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]methanol (PubChem CID 73169110) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]methanol.
| Compound Name | [2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]methanol |
|---|---|
| PubChem CID | 73169110 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | [2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]methanol |
| SMILES | CN(C)CC1=CC=CC1=CO |
| InChI | InChI=1S/C9H13NO/c1-10(2)6-8-4-3-5-9(8)7-11/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | QIVIRRKTMHKEEP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|