C12H23NO — CID 87095833
1-[ethyl-[(4E,6E)-octa-4,6-dienyl]amino]ethanol (PubChem CID 87095833) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-[ethyl-[(4E,6E)-octa-4,6-dienyl]amino]ethanol.
| Compound Name | 1-[ethyl-[(4E,6E)-octa-4,6-dienyl]amino]ethanol |
|---|---|
| PubChem CID | 87095833 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-[ethyl-[(4E,6E)-octa-4,6-dienyl]amino]ethanol |
| SMILES | C/C=C/C=C/CCCN(CC)C(C)O |
| InChI | InChI=1S/C12H23NO/c1-4-6-7-8-9-10-11-13(5-2)12(3)14/h4,6-8,12,14H,5,9-11H2,1-3H3/b6-4+,8-7+ |
| InChIKey | KZJWFDVDUCKDGR-GFGVWQOPSA-N |
| XLogP | 2.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|