C20H29N4O3S+ — CID 7317488
N-ethyl-4-[2-[[4-(furan-2-yl)-2,6-dioxocyclohexyl]methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide (PubChem CID 7317488) has the molecular formula C20H29N4O3S+ and a molecular weight of 405.54 g/mol. Its IUPAC name is N-ethyl-4-[2-[[4-(furan-2-yl)-2,6-dioxocyclohexyl]methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-ethyl-4-[2-[[4-(furan-2-yl)-2,6-dioxocyclohexyl]methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7317488 |
| Molecular Formula | C20H29N4O3S+ |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | N-ethyl-4-[2-[[4-(furan-2-yl)-2,6-dioxocyclohexyl]methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide |
| SMILES | CCNC(=S)N1CC[NH+](CC/N=C/C2C(=O)CC(c3ccco3)CC2=O)CC1 |
| InChI | InChI=1S/C20H28N4O3S/c1-2-22-20(28)24-9-7-23(8-10-24)6-5-21-14-16-17(25)12-15(13-18(16)26)19-4-3-11-27-19/h3-4,11,14-16H,2,5-10,12-13H2,1H3,(H,22,28)/p+1/b21-14+ |
| InChIKey | UFCYCEQGAAONTC-KGENOOAVSA-O |
| XLogP | 0.08 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|