C34H35N5O4 — CID 73256065
2-[10-(2-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 73256065) has the molecular formula C34H35N5O4 and a molecular weight of 577.68 g/mol. Its IUPAC name is 2-[10-(2-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-[10-(2-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 73256065 |
| Molecular Formula | C34H35N5O4 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 2-[10-(2-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | Cc1ccccc1C1c2[nH]c3ccccc3c2CC2C(=O)N(c3ccccc3C(=O)NCCCN3CCOCC3)C(=O)N21 |
| InChI | InChI=1S/C34H35N5O4/c1-22-9-2-3-10-23(22)31-30-26(24-11-4-6-13-27(24)36-30)21-29-33(41)39(34(42)38(29)31)28-14-7-5-12-25(28)32(40)35-15-8-16-37-17-19-43-20-18-37/h2-7,9-14,29,31,36H,8,15-21H2,1H3,(H,35,40) |
| InChIKey | YFPLUTJZUXLEEA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|