C16H20BrCl — CID 73294060
[(1Z)-2-bromo-1-chlorodeca-1,9-dienyl]benzene (PubChem CID 73294060) has the molecular formula C16H20BrCl and a molecular weight of 327.69 g/mol. Its IUPAC name is [(1Z)-2-bromo-1-chlorodeca-1,9-dienyl]benzene.
| Compound Name | [(1Z)-2-bromo-1-chlorodeca-1,9-dienyl]benzene |
|---|---|
| PubChem CID | 73294060 |
| Molecular Formula | C16H20BrCl |
| Molecular Weight | 327.69 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | [(1Z)-2-bromo-1-chlorodeca-1,9-dienyl]benzene |
| SMILES | C=CCCCCCC/C(Br)=C(/Cl)c1ccccc1 |
| InChI | InChI=1S/C16H20BrCl/c1-2-3-4-5-6-10-13-15(17)16(18)14-11-8-7-9-12-14/h2,7-9,11-12H,1,3-6,10,13H2/b16-15- |
| InChIKey | IKEXSGMQYLSZTI-NXVVXOECSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.69 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|