C22H38N3O4+ — CID 7331148
[6-[[(2S,3R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]amino]-6-oxohexyl]azanium (PubChem CID 7331148) has the molecular formula C22H38N3O4+ and a molecular weight of 408.56 g/mol. Its IUPAC name is [6-[[(2S,3R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]amino]-6-oxohexyl]azanium.
| Compound Name | [6-[[(2S,3R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]amino]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 7331148 |
| Molecular Formula | C22H38N3O4+ |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [6-[[(2S,3R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]amino]-6-oxohexyl]azanium |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CCCCC[NH3+])C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H37N3O4/c1-5-16(2)21(25-20(26)9-7-6-8-13-23)22(27)24-14-12-17-10-11-18(28-3)19(15-17)29-4/h10-11,15-16,21H,5-9,12-14,23H2,1-4H3,(H,24,27)(H,25,26)/p+1/t16-,21+/m1/s1 |
| InChIKey | URIUQTKQSJPMKM-IERDGZPVSA-O |
| XLogP | 1.70 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|