C16H13NO6S2 — CID 7331243
2-[(1R,10S)-6-methoxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetic acid (PubChem CID 7331243) has the molecular formula C16H13NO6S2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[(1R,10S)-6-methoxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetic acid.
| Compound Name | 2-[(1R,10S)-6-methoxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetic acid |
|---|---|
| PubChem CID | 7331243 |
| Molecular Formula | C16H13NO6S2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 2-[(1R,10S)-6-methoxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetic acid |
| SMILES | COc1cccc2c1OC(=O)[C@@]1(CC(=O)O)CSc3[nH]c(=O)sc3[C@H]21 |
| InChI | InChI=1S/C16H13NO6S2/c1-22-8-4-2-3-7-10-12-13(17-15(21)25-12)24-6-16(10,5-9(18)19)14(20)23-11(7)8/h2-4,10H,5-6H2,1H3,(H,17,21)(H,18,19)/t10-,16-/m0/s1 |
| InChIKey | DJMSDDQBFQDCPX-QFYYESIMSA-N |
| XLogP | 2.06 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|