C17H28N6O4 — CID 73327503
7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-(4-methylpiperazin-1-yl)-4,5-dihydropurine-2,6-dione (PubChem CID 73327503) has the molecular formula C17H28N6O4 and a molecular weight of 380.45 g/mol. Its IUPAC name is 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-(4-methylpiperazin-1-yl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-(4-methylpiperazin-1-yl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73327503 |
| Molecular Formula | C17H28N6O4 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-(4-methylpiperazin-1-yl)-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCOCC(O)CN1C(N2CCN(C)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C17H28N6O4/c1-4-9-27-11-12(24)10-23-13-14(21(3)17(26)19-15(13)25)18-16(23)22-7-5-20(2)6-8-22/h4,12-14,24H,1,5-11H2,2-3H3,(H,19,25,26) |
| InChIKey | UNAWHEIAAPYLDE-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|