C18H29N5O4 — CID 74688320
8-(azepan-1-yl)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 74688320) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 8-(azepan-1-yl)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(azepan-1-yl)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 74688320 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 8-(azepan-1-yl)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCOCC(O)CN1C(N2CCCCCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C18H29N5O4/c1-3-10-27-12-13(24)11-23-14-15(21(2)18(26)20-16(14)25)19-17(23)22-8-6-4-5-7-9-22/h3,13-15,24H,1,4-12H2,2H3,(H,20,25,26) |
| InChIKey | QVZRSHLGIFTSTO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|