C16H25N5O5 — CID 73452750
7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-morpholin-4-yl-4,5-dihydropurine-2,6-dione (PubChem CID 73452750) has the molecular formula C16H25N5O5 and a molecular weight of 367.41 g/mol. Its IUPAC name is 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-morpholin-4-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-morpholin-4-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73452750 |
| Molecular Formula | C16H25N5O5 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-8-morpholin-4-yl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCOCC(O)CN1C(N2CCOCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C16H25N5O5/c1-3-6-26-10-11(22)9-21-12-13(19(2)16(24)18-14(12)23)17-15(21)20-4-7-25-8-5-20/h3,11-13,22H,1,4-10H2,2H3,(H,18,23,24) |
| InChIKey | NQKHEJYXOJHIDW-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|