C19H30N5O4+ — CID 74688313
8-(cyclohexylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74688313) has the molecular formula C19H30N5O4+ and a molecular weight of 392.48 g/mol. Its IUPAC name is 8-(cyclohexylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74688313 |
| Molecular Formula | C19H30N5O4+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 8-(cyclohexylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CCOCC(O)C[N+]1=C(NC2CCCCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C19H29N5O4/c1-4-10-28-12-14(25)11-24-15-16(22(2)19(27)23(3)17(15)26)21-18(24)20-13-8-6-5-7-9-13/h4,13-15,25H,1,5-12H2,2-3H3/p+1 |
| InChIKey | MVVCSQVZQCZGCJ-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|