C17H26N5O5+ — CID 73329049
7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-8-morpholin-4-ium-4-ylidene-5H-purine-2,6-dione (PubChem CID 73329049) has the molecular formula C17H26N5O5+ and a molecular weight of 380.43 g/mol. Its IUPAC name is 7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-8-morpholin-4-ium-4-ylidene-5H-purine-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-8-morpholin-4-ium-4-ylidene-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 73329049 |
| Molecular Formula | C17H26N5O5+ |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 7-(2-hydroxy-3-prop-2-enoxypropyl)-1,3-dimethyl-8-morpholin-4-ium-4-ylidene-5H-purine-2,6-dione |
| SMILES | C=CCOCC(O)CN1C(=[N+]2CCOCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C17H26N5O5/c1-4-7-27-11-12(23)10-22-13-14(19(2)17(25)20(3)15(13)24)18-16(22)21-5-8-26-9-6-21/h4,12-13,23H,1,5-11H2,2-3H3/q+1 |
| InChIKey | HZHQWNVZTBFOIV-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|