C14H23N5O4 — CID 74688353
8-(dimethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 74688353) has the molecular formula C14H23N5O4 and a molecular weight of 325.37 g/mol. Its IUPAC name is 8-(dimethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(dimethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 74688353 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 8-(dimethylamino)-7-(2-hydroxy-3-prop-2-enoxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCOCC(O)CN1C(N(C)C)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C14H23N5O4/c1-5-6-23-8-9(20)7-19-10-11(15-13(19)17(2)3)18(4)14(22)16-12(10)21/h5,9-11,20H,1,6-8H2,2-4H3,(H,16,21,22) |
| InChIKey | DTDLHGYAMRTMNC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|