C15H24N7O3+ — CID 73327619
2-[8-(azepan-1-ium-1-ylidene)-1,3-dimethyl-2,6-dioxo-5H-purin-7-yl]acetohydrazide (PubChem CID 73327619) has the molecular formula C15H24N7O3+ and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[8-(azepan-1-ium-1-ylidene)-1,3-dimethyl-2,6-dioxo-5H-purin-7-yl]acetohydrazide.
| Compound Name | 2-[8-(azepan-1-ium-1-ylidene)-1,3-dimethyl-2,6-dioxo-5H-purin-7-yl]acetohydrazide |
|---|---|
| PubChem CID | 73327619 |
| Molecular Formula | C15H24N7O3+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[8-(azepan-1-ium-1-ylidene)-1,3-dimethyl-2,6-dioxo-5H-purin-7-yl]acetohydrazide |
| SMILES | CN1C(=O)C2C(=NC(=[N+]3CCCCCC3)N2CC(=O)NN)N(C)C1=O |
| InChI | InChI=1S/C15H23N7O3/c1-19-12-11(13(24)20(2)15(19)25)22(9-10(23)18-16)14(17-12)21-7-5-3-4-6-8-21/h11H,3-9,16H2,1-2H3/p+1 |
| InChIKey | ZIJPJSMGWOGFDA-UHFFFAOYSA-O |
| XLogP | -1.47 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|