C9H15N6O4+ — CID 75098501
2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetohydrazide;hydrate (PubChem CID 75098501) has the molecular formula C9H15N6O4+ and a molecular weight of 271.26 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetohydrazide;hydrate.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetohydrazide;hydrate |
|---|---|
| PubChem CID | 75098501 |
| Molecular Formula | C9H15N6O4+ |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetohydrazide;hydrate |
| SMILES | CN1C(=O)N(CC(=O)NN)C(=O)C2C1=NC=[N+]2C.O |
| InChI | InChI=1S/C9H12N6O3.H2O/c1-13-4-11-7-6(13)8(17)15(3-5(16)12-10)9(18)14(7)2;/h4,6H,3,10H2,1-2H3;1H2/p+1 |
| InChIKey | FNADPBDZNYBJKF-UHFFFAOYSA-O |
| XLogP | -3.50 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|