C10H14N5O3+ — CID 75265117
2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide (PubChem CID 75265117) has the molecular formula C10H14N5O3+ and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 75265117 |
| Molecular Formula | C10H14N5O3+ |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)CN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C10H13N5O3/c1-11-6(16)4-15-9(17)7-8(12-5-13(7)2)14(3)10(15)18/h5,7H,4H2,1-3H3/p+1 |
| InChIKey | COAXHOBFPBPPFA-UHFFFAOYSA-O |
| XLogP | -1.92 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|