C14H22N7O3+ — CID 73327618
2-(1,3-dimethyl-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-7-yl)acetohydrazide (PubChem CID 73327618) has the molecular formula C14H22N7O3+ and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-7-yl)acetohydrazide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-7-yl)acetohydrazide |
|---|---|
| PubChem CID | 73327618 |
| Molecular Formula | C14H22N7O3+ |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-7-yl)acetohydrazide |
| SMILES | CN1C(=O)C2C(=NC(=[N+]3CCCCC3)N2CC(=O)NN)N(C)C1=O |
| InChI | InChI=1S/C14H21N7O3/c1-18-11-10(12(23)19(2)14(18)24)21(8-9(22)17-15)13(16-11)20-6-4-3-5-7-20/h10H,3-8,15H2,1-2H3/p+1 |
| InChIKey | ZHXQYUHTQGCCKU-UHFFFAOYSA-O |
| XLogP | -1.86 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|