C14H20N5O3+ — CID 74536852
3,7-dimethyl-1-(2-oxo-2-piperidin-1-ylethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 74536852) has the molecular formula C14H20N5O3+ and a molecular weight of 306.35 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2-oxo-2-piperidin-1-ylethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(2-oxo-2-piperidin-1-ylethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74536852 |
| Molecular Formula | C14H20N5O3+ |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3,7-dimethyl-1-(2-oxo-2-piperidin-1-ylethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)N(CC(=O)N2CCCCC2)C(=O)C2C1=NC=[N+]2C |
| InChI | InChI=1S/C14H20N5O3/c1-16-9-15-12-11(16)13(21)19(14(22)17(12)2)8-10(20)18-6-4-3-5-7-18/h9,11H,3-8H2,1-2H3/q+1 |
| InChIKey | UBKSZDNEGFWMMX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|